C11H21N2O13P3S — CID 130270395
[hydroxy-[[(3S)-5-(5-methyl-2-oxo-1,6-dihydropyrimidin-3-yl)-3-(sulfanylmethoxy)oxolan-2-yl]methoxy]phosphoryl] phosphono hydrogen phosphate (PubChem CID 130270395) has the molecular formula C11H21N2O13P3S and a molecular weight of 514.28 g/mol. Its IUPAC name is [hydroxy-[[(3S)-5-(5-methyl-2-oxo-1,6-dihydropyrimidin-3-yl)-3-(sulfanylmethoxy)oxolan-2-yl]methoxy]phosphoryl] phosphono hydrogen phosphate.
| Compound Name | [hydroxy-[[(3S)-5-(5-methyl-2-oxo-1,6-dihydropyrimidin-3-yl)-3-(sulfanylmethoxy)oxolan-2-yl]methoxy]phosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 130270395 |
| Molecular Formula | C11H21N2O13P3S |
| Molecular Weight | 514.28 g/mol |
| Exact Mass | 514.00 |
| IUPAC Name | [hydroxy-[[(3S)-5-(5-methyl-2-oxo-1,6-dihydropyrimidin-3-yl)-3-(sulfanylmethoxy)oxolan-2-yl]methoxy]phosphoryl] phosphono hydrogen phosphate |
| SMILES | CC1=CN(C2C[C@H](OCS)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O2)C(=O)NC1 |
| InChI | InChI=1S/C11H21N2O13P3S/c1-7-3-12-11(14)13(4-7)10-2-8(22-6-30)9(24-10)5-23-28(18,19)26-29(20,21)25-27(15,16)17/h4,8-10,30H,2-3,5-6H2,1H3,(H,12,14)(H,18,19)(H,20,21)(H2,15,16,17)/t8-,9?,10?/m0/s1 |
| InChIKey | NGSAYPCHBZGQQQ-IDKOKCKLSA-N |
| XLogP | 0.65 |
| TPSA | 210.62 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.28 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|