C12H23N2O14P3S2 — CID 170657752
[hydroxy-[[(2R,3R,5R)-5-(6-hydroxy-5-methyl-2-oxo-1,6-dihydropyrimidin-3-yl)-3-(methylsulfinothioylmethoxy)oxolan-2-yl]methoxy]phosphoryl] phosphono hydrogen phosphate (PubChem CID 170657752) has the molecular formula C12H23N2O14P3S2 and a molecular weight of 576.37 g/mol. Its IUPAC name is [hydroxy-[[(2R,3R,5R)-5-(6-hydroxy-5-methyl-2-oxo-1,6-dihydropyrimidin-3-yl)-3-(methylsulfinothioylmethoxy)oxolan-2-yl]methoxy]phosphoryl] phosphono hydrogen phosphate.
| Compound Name | [hydroxy-[[(2R,3R,5R)-5-(6-hydroxy-5-methyl-2-oxo-1,6-dihydropyrimidin-3-yl)-3-(methylsulfinothioylmethoxy)oxolan-2-yl]methoxy]phosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 170657752 |
| Molecular Formula | C12H23N2O14P3S2 |
| Molecular Weight | 576.37 g/mol |
| Exact Mass | 575.98 |
| IUPAC Name | [hydroxy-[[(2R,3R,5R)-5-(6-hydroxy-5-methyl-2-oxo-1,6-dihydropyrimidin-3-yl)-3-(methylsulfinothioylmethoxy)oxolan-2-yl]methoxy]phosphoryl] phosphono hydrogen phosphate |
| SMILES | CC1=CN([C@H]2C[C@@H](OCS(C)=S)[C@@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O2)C(=O)NC1O |
| InChI | InChI=1S/C12H23N2O14P3S2/c1-7-4-14(12(16)13-11(7)15)10-3-8(24-6-33(2)32)9(26-10)5-25-30(20,21)28-31(22,23)27-29(17,18)19/h4,8-11,15H,3,5-6H2,1-2H3,(H,13,16)(H,20,21)(H,22,23)(H2,17,18,19)/t8-,9-,10-,11?,33?/m1/s1 |
| InChIKey | PFKKHPJWTSNXDD-YFDBRILZSA-N |
| XLogP | -0.26 |
| TPSA | 230.85 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.37 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|