C12H17BFN4O13P3S2 — CID 174089336
CID 174089336 (PubChem CID 174089336) has the molecular formula C12H17BFN4O13P3S2 and a molecular weight of 612.15 g/mol.
| Compound Name | CID 174089336 |
|---|---|
| PubChem CID | 174089336 |
| Molecular Formula | C12H17BFN4O13P3S2 |
| Molecular Weight | 612.15 g/mol |
| Exact Mass | 611.95 |
| IUPAC Name | — |
| SMILES | [B]SS[C@@H](F)O[C@@H]1C[C@H](n2ccc3c(=O)[nH]c(N)nc32)OC1COP(=O)(O)OP(=O)(O)OP(=O)(O)O |
| InChI | InChI=1S/C12H17BFN4O13P3S2/c13-36-35-11(14)29-6-3-8(18-2-1-5-9(18)16-12(15)17-10(5)19)28-7(6)4-27-33(23,24)31-34(25,26)30-32(20,21)22/h1-2,6-8,11H,3-4H2,(H,23,24)(H,25,26)(H2,20,21,22)(H3,15,16,17,19)/t6-,7?,8-,11+/m1/s1 |
| InChIKey | HFHFPWRJHDUDAW-PPIMFWTNSA-N |
| XLogP | 1.04 |
| TPSA | 254.98 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.15 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|