C13H21N4O13P3S2 — CID 146704572
[[(2R,3S)-4-(2-amino-4-oxo-3H-pyrrolo[2,3-d]pyrimidin-7-yl)-3-[(methyldisulfanyl)methoxy]oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 146704572) has the molecular formula C13H21N4O13P3S2 and a molecular weight of 598.38 g/mol. Its IUPAC name is [[(2R,3S)-4-(2-amino-4-oxo-3H-pyrrolo[2,3-d]pyrimidin-7-yl)-3-[(methyldisulfanyl)methoxy]oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2R,3S)-4-(2-amino-4-oxo-3H-pyrrolo[2,3-d]pyrimidin-7-yl)-3-[(methyldisulfanyl)methoxy]oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 146704572 |
| Molecular Formula | C13H21N4O13P3S2 |
| Molecular Weight | 598.38 g/mol |
| Exact Mass | 597.98 |
| IUPAC Name | [[(2R,3S)-4-(2-amino-4-oxo-3H-pyrrolo[2,3-d]pyrimidin-7-yl)-3-[(methyldisulfanyl)methoxy]oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | CSSCO[C@H]1C(n2ccc3c(=O)[nH]c(N)nc32)CO[C@@H]1COP(=O)(O)OP(=O)(O)OP(=O)(O)O |
| InChI | InChI=1S/C13H21N4O13P3S2/c1-34-35-6-27-10-8(17-3-2-7-11(17)15-13(14)16-12(7)18)4-26-9(10)5-28-32(22,23)30-33(24,25)29-31(19,20)21/h2-3,8-10H,4-6H2,1H3,(H,22,23)(H,24,25)(H2,19,20,21)(H3,14,15,16,18)/t8?,9-,10+/m1/s1 |
| InChIKey | QXDIKECBCWQPDR-XVBQNVSMSA-N |
| XLogP | 0.94 |
| TPSA | 254.98 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.38 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|