C12H17ClFN4O13P3 — CID 137177654
[[(2R,4R,5R)-5-(2-amino-4-oxo-3H-pyrrolo[2,3-d]pyrimidin-7-yl)-4-chloro-4-(fluoromethyl)-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 137177654) has the molecular formula C12H17ClFN4O13P3 and a molecular weight of 572.66 g/mol. Its IUPAC name is [[(2R,4R,5R)-5-(2-amino-4-oxo-3H-pyrrolo[2,3-d]pyrimidin-7-yl)-4-chloro-4-(fluoromethyl)-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2R,4R,5R)-5-(2-amino-4-oxo-3H-pyrrolo[2,3-d]pyrimidin-7-yl)-4-chloro-4-(fluoromethyl)-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 137177654 |
| Molecular Formula | C12H17ClFN4O13P3 |
| Molecular Weight | 572.66 g/mol |
| Exact Mass | 571.97 |
| IUPAC Name | [[(2R,4R,5R)-5-(2-amino-4-oxo-3H-pyrrolo[2,3-d]pyrimidin-7-yl)-4-chloro-4-(fluoromethyl)-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | Nc1nc2c(ccn2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)C(O)[C@]2(Cl)CF)c(=O)[nH]1 |
| InChI | InChI=1S/C12H17ClFN4O13P3/c13-12(4-14)7(19)6(3-28-33(24,25)31-34(26,27)30-32(21,22)23)29-10(12)18-2-1-5-8(18)16-11(15)17-9(5)20/h1-2,6-7,10,19H,3-4H2,(H,24,25)(H,26,27)(H2,21,22,23)(H3,15,16,17,20)/t6-,7?,10-,12-/m1/s1 |
| InChIKey | NYSJZMRZVOIVKS-VEVHYLJNSA-N |
| XLogP | -0.14 |
| TPSA | 265.98 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.66 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|