C14H20N5O14P3 — CID 163611915
[[(2R,5R)-5-[2-amino-5-(3-aminoprop-1-ynyl)-4-oxo-3H-pyrrolo[2,3-d]pyrimidin-7-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 163611915) has the molecular formula C14H20N5O14P3 and a molecular weight of 575.26 g/mol. Its IUPAC name is [[(2R,5R)-5-[2-amino-5-(3-aminoprop-1-ynyl)-4-oxo-3H-pyrrolo[2,3-d]pyrimidin-7-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2R,5R)-5-[2-amino-5-(3-aminoprop-1-ynyl)-4-oxo-3H-pyrrolo[2,3-d]pyrimidin-7-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 163611915 |
| Molecular Formula | C14H20N5O14P3 |
| Molecular Weight | 575.26 g/mol |
| Exact Mass | 575.02 |
| IUPAC Name | [[(2R,5R)-5-[2-amino-5-(3-aminoprop-1-ynyl)-4-oxo-3H-pyrrolo[2,3-d]pyrimidin-7-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | NCC#Cc1cn([C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)C(O)C2O)c2nc(N)[nH]c(=O)c12 |
| InChI | InChI=1S/C14H20N5O14P3/c15-3-1-2-6-4-19(11-8(6)12(22)18-14(16)17-11)13-10(21)9(20)7(31-13)5-30-35(26,27)33-36(28,29)32-34(23,24)25/h4,7,9-10,13,20-21H,3,5,15H2,(H,26,27)(H,28,29)(H2,23,24,25)(H3,16,17,18,22)/t7-,9?,10?,13-/m1/s1 |
| InChIKey | HGQSVCDNBILIEI-QQNFCMCUSA-N |
| XLogP | -2.42 |
| TPSA | 312.23 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.26 |
| LogP ≤ 5 | -2.42 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|