C11H14N5Na2O7P — CID 175699079
disodium;[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxy-5-methyloxolan-2-yl]methyl phosphate (PubChem CID 175699079) has the molecular formula C11H14N5Na2O7P and a molecular weight of 405.22 g/mol. Its IUPAC name is disodium;[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxy-5-methyloxolan-2-yl]methyl phosphate.
| Compound Name | disodium;[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxy-5-methyloxolan-2-yl]methyl phosphate |
|---|---|
| PubChem CID | 175699079 |
| Molecular Formula | C11H14N5Na2O7P |
| Molecular Weight | 405.22 g/mol |
| Exact Mass | 405.04 |
| IUPAC Name | disodium;[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxy-5-methyloxolan-2-yl]methyl phosphate |
| SMILES | C[C@@]1(n2cnc3c(N)ncnc32)O[C@H](COP(=O)([O-])[O-])[C@@H](O)[C@H]1O.[Na+].[Na+] |
| InChI | InChI=1S/C11H16N5O7P.2Na/c1-11(16-4-15-6-9(12)13-3-14-10(6)16)8(18)7(17)5(23-11)2-22-24(19,20)21;;/h3-5,7-8,17-18H,2H2,1H3,(H2,12,13,14)(H2,19,20,21);;/q;2*+1/p-2/t5-,7-,8-,11-;;/m1../s1 |
| InChIKey | SBBZBPROPYBWDM-LYYWGVPGSA-L |
| XLogP | -8.94 |
| TPSA | 191.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.22 |
| LogP ≤ 5 | -8.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|