C18H30N5O10P — CID 70465334
ethyl 6-[(2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]hexanoate;phosphoric acid (PubChem CID 70465334) has the molecular formula C18H30N5O10P and a molecular weight of 507.44 g/mol. Its IUPAC name is ethyl 6-[(2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]hexanoate;phosphoric acid.
| Compound Name | ethyl 6-[(2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]hexanoate;phosphoric acid |
|---|---|
| PubChem CID | 70465334 |
| Molecular Formula | C18H30N5O10P |
| Molecular Weight | 507.44 g/mol |
| Exact Mass | 507.17 |
| IUPAC Name | ethyl 6-[(2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]hexanoate;phosphoric acid |
| SMILES | CCOC(=O)CCCCC[C@@]1(n2cnc3c(N)ncnc32)O[C@H](CO)[C@@H](O)[C@H]1O.O=P(O)(O)O |
| InChI | InChI=1S/C18H27N5O6.H3O4P/c1-2-28-12(25)6-4-3-5-7-18(15(27)14(26)11(8-24)29-18)23-10-22-13-16(19)20-9-21-17(13)23;1-5(2,3)4/h9-11,14-15,24,26-27H,2-8H2,1H3,(H2,19,20,21);(H3,1,2,3,4)/t11-,14-,15-,18-;/m1./s1 |
| InChIKey | CZFZRDNEBAKLIK-SINQMCSXSA-N |
| XLogP | -1.24 |
| TPSA | 243.60 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.44 |
| LogP ≤ 5 | -1.24 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|