C26H35N5O7 — CID 89048763
[4-[[(2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]methyl]-2-methoxyphenyl] octanoate (PubChem CID 89048763) has the molecular formula C26H35N5O7 and a molecular weight of 529.59 g/mol. Its IUPAC name is [4-[[(2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]methyl]-2-methoxyphenyl] octanoate.
| Compound Name | [4-[[(2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]methyl]-2-methoxyphenyl] octanoate |
|---|---|
| PubChem CID | 89048763 |
| Molecular Formula | C26H35N5O7 |
| Molecular Weight | 529.59 g/mol |
| Exact Mass | 529.25 |
| IUPAC Name | [4-[[(2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]methyl]-2-methoxyphenyl] octanoate |
| SMILES | CCCCCCCC(=O)Oc1ccc(C[C@@]2(n3cnc4c(N)ncnc43)O[C@H](CO)[C@@H](O)[C@H]2O)cc1OC |
| InChI | InChI=1S/C26H35N5O7/c1-3-4-5-6-7-8-20(33)37-17-10-9-16(11-18(17)36-2)12-26(23(35)22(34)19(13-32)38-26)31-15-30-21-24(27)28-14-29-25(21)31/h9-11,14-15,19,22-23,32,34-35H,3-8,12-13H2,1-2H3,(H2,27,28,29)/t19-,22-,23-,26-/m1/s1 |
| InChIKey | DINGDWVYBPCZCV-VJUOEERUSA-N |
| XLogP | 1.69 |
| TPSA | 175.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.59 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|