C19H22IN7O5 — CID 142668279
2-[(2S,3S,4R,5R)-5-[(4-amino-3-iodophenyl)methyl]-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]-2-hydroxy-N-methylacetamide (PubChem CID 142668279) has the molecular formula C19H22IN7O5 and a molecular weight of 555.33 g/mol. Its IUPAC name is 2-[(2S,3S,4R,5R)-5-[(4-amino-3-iodophenyl)methyl]-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]-2-hydroxy-N-methylacetamide.
| Compound Name | 2-[(2S,3S,4R,5R)-5-[(4-amino-3-iodophenyl)methyl]-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]-2-hydroxy-N-methylacetamide |
|---|---|
| PubChem CID | 142668279 |
| Molecular Formula | C19H22IN7O5 |
| Molecular Weight | 555.33 g/mol |
| Exact Mass | 555.07 |
| IUPAC Name | 2-[(2S,3S,4R,5R)-5-[(4-amino-3-iodophenyl)methyl]-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]-2-hydroxy-N-methylacetamide |
| SMILES | CNC(=O)C(O)[C@H]1O[C@@](Cc2ccc(N)c(I)c2)(n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C19H22IN7O5/c1-23-18(31)13(29)14-12(28)15(30)19(32-14,5-8-2-3-10(21)9(20)4-8)27-7-26-11-16(22)24-6-25-17(11)27/h2-4,6-7,12-15,28-30H,5,21H2,1H3,(H,23,31)(H2,22,24,25)/t12-,13?,14+,15-,19-/m1/s1 |
| InChIKey | MJHYIKDJLAZMCF-NBLWIYHLSA-N |
| XLogP | -1.28 |
| TPSA | 194.66 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.33 |
| LogP ≤ 5 | -1.28 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|