C14H22N5O7P — CID 67826825
[(2S,3R,4S,5R)-2-(6-aminopurin-9-yl)-3,4-dihydroxy-5-(1-hydroxypentyl)oxolan-2-yl]phosphonic acid (PubChem CID 67826825) has the molecular formula C14H22N5O7P and a molecular weight of 403.33 g/mol. Its IUPAC name is [(2S,3R,4S,5R)-2-(6-aminopurin-9-yl)-3,4-dihydroxy-5-(1-hydroxypentyl)oxolan-2-yl]phosphonic acid.
| Compound Name | [(2S,3R,4S,5R)-2-(6-aminopurin-9-yl)-3,4-dihydroxy-5-(1-hydroxypentyl)oxolan-2-yl]phosphonic acid |
|---|---|
| PubChem CID | 67826825 |
| Molecular Formula | C14H22N5O7P |
| Molecular Weight | 403.33 g/mol |
| Exact Mass | 403.13 |
| IUPAC Name | [(2S,3R,4S,5R)-2-(6-aminopurin-9-yl)-3,4-dihydroxy-5-(1-hydroxypentyl)oxolan-2-yl]phosphonic acid |
| SMILES | CCCCC(O)[C@H]1O[C@](n2cnc3c(N)ncnc32)(P(=O)(O)O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C14H22N5O7P/c1-2-3-4-7(20)10-9(21)11(22)14(26-10,27(23,24)25)19-6-18-8-12(15)16-5-17-13(8)19/h5-7,9-11,20-22H,2-4H2,1H3,(H2,15,16,17)(H2,23,24,25)/t7?,9-,10-,11-,14+/m1/s1 |
| InChIKey | UZJXXROTZZJZAD-MTXMJKIYSA-N |
| XLogP | -1.13 |
| TPSA | 197.07 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.33 |
| LogP ≤ 5 | -1.13 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|