C10H12ClN4O7P — CID 174726573
[(3R,4S,5R)-2-(6-chloropurin-9-yl)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]phosphonic acid (PubChem CID 174726573) has the molecular formula C10H12ClN4O7P and a molecular weight of 366.65 g/mol. Its IUPAC name is [(3R,4S,5R)-2-(6-chloropurin-9-yl)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]phosphonic acid.
| Compound Name | [(3R,4S,5R)-2-(6-chloropurin-9-yl)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]phosphonic acid |
|---|---|
| PubChem CID | 174726573 |
| Molecular Formula | C10H12ClN4O7P |
| Molecular Weight | 366.65 g/mol |
| Exact Mass | 366.01 |
| IUPAC Name | [(3R,4S,5R)-2-(6-chloropurin-9-yl)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]phosphonic acid |
| SMILES | O=P(O)(O)C1(n2cnc3c(Cl)ncnc32)O[C@H](CO)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C10H12ClN4O7P/c11-8-5-9(13-2-12-8)15(3-14-5)10(23(19,20)21)7(18)6(17)4(1-16)22-10/h2-4,6-7,16-18H,1H2,(H2,19,20,21)/t4-,6-,7-,10?/m1/s1 |
| InChIKey | QIXBXXWNCKNFGJ-VTHZCTBJSA-N |
| XLogP | -1.62 |
| TPSA | 171.05 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.65 |
| LogP ≤ 5 | -1.62 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|