C10H11BrN4O5 — CID 137229377
9-[(2S,3R,4S,5R)-2-bromo-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one (PubChem CID 137229377) has the molecular formula C10H11BrN4O5 and a molecular weight of 347.13 g/mol. Its IUPAC name is 9-[(2S,3R,4S,5R)-2-bromo-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one.
| Compound Name | 9-[(2S,3R,4S,5R)-2-bromo-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one |
|---|---|
| PubChem CID | 137229377 |
| Molecular Formula | C10H11BrN4O5 |
| Molecular Weight | 347.13 g/mol |
| Exact Mass | 345.99 |
| IUPAC Name | 9-[(2S,3R,4S,5R)-2-bromo-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one |
| SMILES | O=c1[nH]cnc2c1ncn2[C@]1(Br)O[C@H](CO)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C10H11BrN4O5/c11-10(7(18)6(17)4(1-16)20-10)15-3-14-5-8(15)12-2-13-9(5)19/h2-4,6-7,16-18H,1H2,(H,12,13,19)/t4-,6-,7-,10+/m1/s1 |
| InChIKey | PTVKQBWKHJTRLL-CRKDRTNXSA-N |
| XLogP | -1.76 |
| TPSA | 133.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.13 |
| LogP ≤ 5 | -1.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|