C22H27N5O7 — CID 89412794
[4-[[[9-[(2R,4R,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl]amino]methyl]-2-methoxyphenyl] butanoate (PubChem CID 89412794) has the molecular formula C22H27N5O7 and a molecular weight of 473.49 g/mol. Its IUPAC name is [4-[[[9-[(2R,4R,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl]amino]methyl]-2-methoxyphenyl] butanoate.
| Compound Name | [4-[[[9-[(2R,4R,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl]amino]methyl]-2-methoxyphenyl] butanoate |
|---|---|
| PubChem CID | 89412794 |
| Molecular Formula | C22H27N5O7 |
| Molecular Weight | 473.49 g/mol |
| Exact Mass | 473.19 |
| IUPAC Name | [4-[[[9-[(2R,4R,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl]amino]methyl]-2-methoxyphenyl] butanoate |
| SMILES | CCCC(=O)Oc1ccc(CNc2ncnc3c2ncn3[C@@H]2O[C@H](CO)[C@H](O)C2O)cc1OC |
| InChI | InChI=1S/C22H27N5O7/c1-3-4-16(29)33-13-6-5-12(7-14(13)32-2)8-23-20-17-21(25-10-24-20)27(11-26-17)22-19(31)18(30)15(9-28)34-22/h5-7,10-11,15,18-19,22,28,30-31H,3-4,8-9H2,1-2H3,(H,23,24,25)/t15-,18+,19?,22-/m1/s1 |
| InChIKey | JTKGROQXDPPDGF-IXOLAJPXSA-N |
| XLogP | 0.76 |
| TPSA | 161.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.49 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|