C27H37N5O7 — CID 50902466
[(2R,3S,4R,5R)-5-[6-[(3,4-dimethoxyphenyl)methylamino]purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methyl octanoate (PubChem CID 50902466) has the molecular formula C27H37N5O7 and a molecular weight of 543.62 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-[6-[(3,4-dimethoxyphenyl)methylamino]purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methyl octanoate.
| Compound Name | [(2R,3S,4R,5R)-5-[6-[(3,4-dimethoxyphenyl)methylamino]purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methyl octanoate |
|---|---|
| PubChem CID | 50902466 |
| Molecular Formula | C27H37N5O7 |
| Molecular Weight | 543.62 g/mol |
| Exact Mass | 543.27 |
| IUPAC Name | [(2R,3S,4R,5R)-5-[6-[(3,4-dimethoxyphenyl)methylamino]purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methyl octanoate |
| SMILES | CCCCCCCC(=O)OC[C@H]1O[C@@H](n2cnc3c(NCc4ccc(OC)c(OC)c4)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C27H37N5O7/c1-4-5-6-7-8-9-21(33)38-14-20-23(34)24(35)27(39-20)32-16-31-22-25(29-15-30-26(22)32)28-13-17-10-11-18(36-2)19(12-17)37-3/h10-12,15-16,20,23-24,27,34-35H,4-9,13-14H2,1-3H3,(H,28,29,30)/t20-,23-,24-,27-/m1/s1 |
| InChIKey | XCMGMLBFZFLTRC-ZCIWVVNKSA-N |
| XLogP | 2.98 |
| TPSA | 150.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.62 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|