C18H27N5O5 — CID 14481575
[(2R,3S,4R,5R)-5-[6-(dimethylamino)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methyl hexanoate (PubChem CID 14481575) has the molecular formula C18H27N5O5 and a molecular weight of 393.44 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-[6-(dimethylamino)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methyl hexanoate.
| Compound Name | [(2R,3S,4R,5R)-5-[6-(dimethylamino)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methyl hexanoate |
|---|---|
| PubChem CID | 14481575 |
| Molecular Formula | C18H27N5O5 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.20 |
| IUPAC Name | [(2R,3S,4R,5R)-5-[6-(dimethylamino)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methyl hexanoate |
| SMILES | CCCCCC(=O)OC[C@H]1O[C@@H](n2cnc3c(N(C)C)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C18H27N5O5/c1-4-5-6-7-12(24)27-8-11-14(25)15(26)18(28-11)23-10-21-13-16(22(2)3)19-9-20-17(13)23/h9-11,14-15,18,25-26H,4-8H2,1-3H3/t11-,14-,15-,18-/m1/s1 |
| InChIKey | MEHXYXHTKUOYLT-XKLVTHTNSA-N |
| XLogP | 0.63 |
| TPSA | 122.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|