C27H27N5O8 — CID 50902646
[(2R,3S,4R,5R)-3,4-dihydroxy-5-[6-[(4-hydroxyphenyl)methylamino]purin-9-yl]oxolan-2-yl]methyl (E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate (PubChem CID 50902646) has the molecular formula C27H27N5O8 and a molecular weight of 549.54 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-3,4-dihydroxy-5-[6-[(4-hydroxyphenyl)methylamino]purin-9-yl]oxolan-2-yl]methyl (E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate.
| Compound Name | [(2R,3S,4R,5R)-3,4-dihydroxy-5-[6-[(4-hydroxyphenyl)methylamino]purin-9-yl]oxolan-2-yl]methyl (E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 50902646 |
| Molecular Formula | C27H27N5O8 |
| Molecular Weight | 549.54 g/mol |
| Exact Mass | 549.19 |
| IUPAC Name | [(2R,3S,4R,5R)-3,4-dihydroxy-5-[6-[(4-hydroxyphenyl)methylamino]purin-9-yl]oxolan-2-yl]methyl (E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate |
| SMILES | COc1cc(/C=C/C(=O)OC[C@H]2O[C@@H](n3cnc4c(NCc5ccc(O)cc5)ncnc43)[C@H](O)[C@@H]2O)ccc1O |
| InChI | InChI=1S/C27H27N5O8/c1-38-19-10-15(4-8-18(19)34)5-9-21(35)39-12-20-23(36)24(37)27(40-20)32-14-31-22-25(29-13-30-26(22)32)28-11-16-2-6-17(33)7-3-16/h2-10,13-14,20,23-24,27,33-34,36-37H,11-12H2,1H3,(H,28,29,30)/b9-5+/t20-,23-,24-,27-/m1/s1 |
| InChIKey | MQXGWYWYYKMRTJ-FCHFUPBFSA-N |
| XLogP | 1.73 |
| TPSA | 181.31 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.54 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|