C28H27N5O7 — CID 123778106
[(2R,4S,5R)-5-[6-(1,3-benzodioxol-5-ylmethylamino)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methyl 3-(4-methylphenyl)prop-2-enoate (PubChem CID 123778106) has the molecular formula C28H27N5O7 and a molecular weight of 545.55 g/mol. Its IUPAC name is [(2R,4S,5R)-5-[6-(1,3-benzodioxol-5-ylmethylamino)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methyl 3-(4-methylphenyl)prop-2-enoate.
| Compound Name | [(2R,4S,5R)-5-[6-(1,3-benzodioxol-5-ylmethylamino)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methyl 3-(4-methylphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 123778106 |
| Molecular Formula | C28H27N5O7 |
| Molecular Weight | 545.55 g/mol |
| Exact Mass | 545.19 |
| IUPAC Name | [(2R,4S,5R)-5-[6-(1,3-benzodioxol-5-ylmethylamino)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methyl 3-(4-methylphenyl)prop-2-enoate |
| SMILES | Cc1ccc(C=CC(=O)OC[C@H]2O[C@@H](n3cnc4c(NCc5ccc6c(c5)OCO6)ncnc43)[C@@H](O)C2O)cc1 |
| InChI | InChI=1S/C28H27N5O7/c1-16-2-4-17(5-3-16)7-9-22(34)37-12-21-24(35)25(36)28(40-21)33-14-32-23-26(30-13-31-27(23)33)29-11-18-6-8-19-20(10-18)39-15-38-19/h2-10,13-14,21,24-25,28,35-36H,11-12,15H2,1H3,(H,29,30,31)/t21-,24?,25+,28-/m1/s1 |
| InChIKey | RYUSKXKHLIPWRM-NZENDAIASA-N |
| XLogP | 2.35 |
| TPSA | 150.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.55 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|