C26H33N5O8 — CID 89412389
[(2R,4S,5R)-5-[6-[(4-butanoyloxy-3-methoxyphenyl)methylamino]purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methyl butanoate (PubChem CID 89412389) has the molecular formula C26H33N5O8 and a molecular weight of 543.58 g/mol. Its IUPAC name is [(2R,4S,5R)-5-[6-[(4-butanoyloxy-3-methoxyphenyl)methylamino]purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methyl butanoate.
| Compound Name | [(2R,4S,5R)-5-[6-[(4-butanoyloxy-3-methoxyphenyl)methylamino]purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methyl butanoate |
|---|---|
| PubChem CID | 89412389 |
| Molecular Formula | C26H33N5O8 |
| Molecular Weight | 543.58 g/mol |
| Exact Mass | 543.23 |
| IUPAC Name | [(2R,4S,5R)-5-[6-[(4-butanoyloxy-3-methoxyphenyl)methylamino]purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methyl butanoate |
| SMILES | CCCC(=O)OC[C@H]1O[C@@H](n2cnc3c(NCc4ccc(OC(=O)CCC)c(OC)c4)ncnc32)[C@@H](O)C1O |
| InChI | InChI=1S/C26H33N5O8/c1-4-6-19(32)37-12-18-22(34)23(35)26(39-18)31-14-30-21-24(28-13-29-25(21)31)27-11-15-8-9-16(17(10-15)36-3)38-20(33)7-5-2/h8-10,13-14,18,22-23,26,34-35H,4-7,11-12H2,1-3H3,(H,27,28,29)/t18-,22?,23+,26-/m1/s1 |
| InChIKey | LHBSYYIRIZDFNZ-RCTVPMLTSA-N |
| XLogP | 2.12 |
| TPSA | 167.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.58 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|