C15H20IN5O5 — CID 100938196
[(2S,3S,4R,5R)-2-(6-aminopurin-9-yl)-4-hydroxy-5-(hydroxymethyl)-3-iodooxolan-2-yl] 2,2-dimethylpropanoate (PubChem CID 100938196) has the molecular formula C15H20IN5O5 and a molecular weight of 477.26 g/mol. Its IUPAC name is [(2S,3S,4R,5R)-2-(6-aminopurin-9-yl)-4-hydroxy-5-(hydroxymethyl)-3-iodooxolan-2-yl] 2,2-dimethylpropanoate.
| Compound Name | [(2S,3S,4R,5R)-2-(6-aminopurin-9-yl)-4-hydroxy-5-(hydroxymethyl)-3-iodooxolan-2-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 100938196 |
| Molecular Formula | C15H20IN5O5 |
| Molecular Weight | 477.26 g/mol |
| Exact Mass | 477.05 |
| IUPAC Name | [(2S,3S,4R,5R)-2-(6-aminopurin-9-yl)-4-hydroxy-5-(hydroxymethyl)-3-iodooxolan-2-yl] 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)O[C@@]1(n2cnc3c(N)ncnc32)O[C@H](CO)[C@@H](O)[C@@H]1I |
| InChI | InChI=1S/C15H20IN5O5/c1-14(2,3)13(24)26-15(10(16)9(23)7(4-22)25-15)21-6-20-8-11(17)18-5-19-12(8)21/h5-7,9-10,22-23H,4H2,1-3H3,(H2,17,18,19)/t7-,9-,10+,15+/m1/s1 |
| InChIKey | ASBXYGPQWYOBSY-JWUPAISJSA-N |
| XLogP | 0.16 |
| TPSA | 145.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.26 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|