C38H28N6O9 — CID 69290009
[(2S,3R,4R,5S)-2-(6-amino-2-nitropurin-9-yl)-2,3,4-tribenzoyl-5-(hydroxymethyl)oxolan-3-yl] benzoate (PubChem CID 69290009) has the molecular formula C38H28N6O9 and a molecular weight of 712.68 g/mol. Its IUPAC name is [(2S,3R,4R,5S)-2-(6-amino-2-nitropurin-9-yl)-2,3,4-tribenzoyl-5-(hydroxymethyl)oxolan-3-yl] benzoate.
| Compound Name | [(2S,3R,4R,5S)-2-(6-amino-2-nitropurin-9-yl)-2,3,4-tribenzoyl-5-(hydroxymethyl)oxolan-3-yl] benzoate |
|---|---|
| PubChem CID | 69290009 |
| Molecular Formula | C38H28N6O9 |
| Molecular Weight | 712.68 g/mol |
| Exact Mass | 712.19 |
| IUPAC Name | [(2S,3R,4R,5S)-2-(6-amino-2-nitropurin-9-yl)-2,3,4-tribenzoyl-5-(hydroxymethyl)oxolan-3-yl] benzoate |
| SMILES | Nc1nc([N+](=O)[O-])nc2c1ncn2[C@]1(C(=O)c2ccccc2)O[C@H](CO)[C@@H](C(=O)c2ccccc2)[C@]1(OC(=O)c1ccccc1)C(=O)c1ccccc1 |
| InChI | InChI=1S/C38H28N6O9/c39-33-29-34(42-36(41-33)44(50)51)43(22-40-29)38(32(48)25-17-9-3-10-18-25)37(31(47)24-15-7-2-8-16-24,53-35(49)26-19-11-4-12-20-26)28(27(21-45)52-38)30(46)23-13-5-1-6-14-23/h1-20,22,27-28,45H,21H2,(H2,39,41,42)/t27-,28+,37+,38-/m1/s1 |
| InChIKey | NFIQSPQIORMBJW-AKAMJVKKSA-N |
| XLogP | 4.22 |
| TPSA | 219.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.68 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|