C39H30N6O11 — CID 67530357
[(2R,3S,4R,5R)-5-(6-amino-2-nitropurin-9-yl)-3,5-dibenzoyl-4-benzoyloxy-2-(hydroxymethyl)-4-methoxyoxolan-3-yl] benzoate (PubChem CID 67530357) has the molecular formula C39H30N6O11 and a molecular weight of 758.70 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-(6-amino-2-nitropurin-9-yl)-3,5-dibenzoyl-4-benzoyloxy-2-(hydroxymethyl)-4-methoxyoxolan-3-yl] benzoate.
| Compound Name | [(2R,3S,4R,5R)-5-(6-amino-2-nitropurin-9-yl)-3,5-dibenzoyl-4-benzoyloxy-2-(hydroxymethyl)-4-methoxyoxolan-3-yl] benzoate |
|---|---|
| PubChem CID | 67530357 |
| Molecular Formula | C39H30N6O11 |
| Molecular Weight | 758.70 g/mol |
| Exact Mass | 758.20 |
| IUPAC Name | [(2R,3S,4R,5R)-5-(6-amino-2-nitropurin-9-yl)-3,5-dibenzoyl-4-benzoyloxy-2-(hydroxymethyl)-4-methoxyoxolan-3-yl] benzoate |
| SMILES | CO[C@@]1(OC(=O)c2ccccc2)[C@@](OC(=O)c2ccccc2)(C(=O)c2ccccc2)[C@@H](CO)O[C@@]1(C(=O)c1ccccc1)n1cnc2c(N)nc([N+](=O)[O-])nc21 |
| InChI | InChI=1S/C39H30N6O11/c1-53-39(56-35(50)27-20-12-5-13-21-27)37(30(47)24-14-6-2-7-15-24,55-34(49)26-18-10-4-11-19-26)28(22-46)54-38(39,31(48)25-16-8-3-9-17-25)44-23-41-29-32(40)42-36(45(51)52)43-33(29)44/h2-21,23,28,46H,22H2,1H3,(H2,40,42,43)/t28-,37+,38-,39-/m1/s1 |
| InChIKey | XVCKIEYSDHGIFK-JIPMINFSSA-N |
| XLogP | 3.92 |
| TPSA | 238.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 758.70 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|