C13H15N7O9 — CID 57162602
2-[(2R,5R)-5-(6-amino-2-nitropurin-9-yl)-3-(2-amino-2-oxoethyl)-3,4-dihydroxyoxolan-2-yl]-2-hydroxyacetic acid (PubChem CID 57162602) has the molecular formula C13H15N7O9 and a molecular weight of 413.30 g/mol. Its IUPAC name is 2-[(2R,5R)-5-(6-amino-2-nitropurin-9-yl)-3-(2-amino-2-oxoethyl)-3,4-dihydroxyoxolan-2-yl]-2-hydroxyacetic acid.
| Compound Name | 2-[(2R,5R)-5-(6-amino-2-nitropurin-9-yl)-3-(2-amino-2-oxoethyl)-3,4-dihydroxyoxolan-2-yl]-2-hydroxyacetic acid |
|---|---|
| PubChem CID | 57162602 |
| Molecular Formula | C13H15N7O9 |
| Molecular Weight | 413.30 g/mol |
| Exact Mass | 413.09 |
| IUPAC Name | 2-[(2R,5R)-5-(6-amino-2-nitropurin-9-yl)-3-(2-amino-2-oxoethyl)-3,4-dihydroxyoxolan-2-yl]-2-hydroxyacetic acid |
| SMILES | NC(=O)CC1(O)C(O)[C@H](n2cnc3c(N)nc([N+](=O)[O-])nc32)O[C@@H]1C(O)C(=O)O |
| InChI | InChI=1S/C13H15N7O9/c14-3(21)1-13(26)6(23)10(29-7(13)5(22)11(24)25)19-2-16-4-8(15)17-12(20(27)28)18-9(4)19/h2,5-7,10,22-23,26H,1H2,(H2,14,21)(H,24,25)(H2,15,17,18)/t5?,6?,7-,10-,13?/m1/s1 |
| InChIKey | YFHHCUUIMCZOQV-WSLJQQELSA-N |
| XLogP | -3.37 |
| TPSA | 263.07 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.30 |
| LogP ≤ 5 | -3.37 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|