C12H14N6O8 — CID 141193556
(2R,3S,4R,5R)-2-(6-amino-2-nitropurin-9-yl)-3,4-dihydroxy-5-(hydroxymethyl)-3-methoxyoxolane-2-carbaldehyde (PubChem CID 141193556) has the molecular formula C12H14N6O8 and a molecular weight of 370.28 g/mol. Its IUPAC name is (2R,3S,4R,5R)-2-(6-amino-2-nitropurin-9-yl)-3,4-dihydroxy-5-(hydroxymethyl)-3-methoxyoxolane-2-carbaldehyde.
| Compound Name | (2R,3S,4R,5R)-2-(6-amino-2-nitropurin-9-yl)-3,4-dihydroxy-5-(hydroxymethyl)-3-methoxyoxolane-2-carbaldehyde |
|---|---|
| PubChem CID | 141193556 |
| Molecular Formula | C12H14N6O8 |
| Molecular Weight | 370.28 g/mol |
| Exact Mass | 370.09 |
| IUPAC Name | (2R,3S,4R,5R)-2-(6-amino-2-nitropurin-9-yl)-3,4-dihydroxy-5-(hydroxymethyl)-3-methoxyoxolane-2-carbaldehyde |
| SMILES | CO[C@@]1(O)[C@H](O)[C@@H](CO)O[C@@]1(C=O)n1cnc2c(N)nc([N+](=O)[O-])nc21 |
| InChI | InChI=1S/C12H14N6O8/c1-25-12(22)7(21)5(2-19)26-11(12,3-20)17-4-14-6-8(13)15-10(18(23)24)16-9(6)17/h3-5,7,19,21-22H,2H2,1H3,(H2,13,15,16)/t5-,7-,11-,12+/m1/s1 |
| InChIKey | ZBVUDEDALTVSBU-XWWRSZOLSA-N |
| XLogP | -2.74 |
| TPSA | 208.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.28 |
| LogP ≤ 5 | -2.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|