C27H35FN6O6 — CID 67878995
1-[(2S,3S,4R,5R)-2-(6-aminopurin-9-yl)-3-[1-(2-fluorophenyl)-4-methoxypiperidin-4-yl]-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2,2-dimethylpropan-1-one (PubChem CID 67878995) has the molecular formula C27H35FN6O6 and a molecular weight of 558.61 g/mol. Its IUPAC name is 1-[(2S,3S,4R,5R)-2-(6-aminopurin-9-yl)-3-[1-(2-fluorophenyl)-4-methoxypiperidin-4-yl]-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2,2-dimethylpropan-1-one.
| Compound Name | 1-[(2S,3S,4R,5R)-2-(6-aminopurin-9-yl)-3-[1-(2-fluorophenyl)-4-methoxypiperidin-4-yl]-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2,2-dimethylpropan-1-one |
|---|---|
| PubChem CID | 67878995 |
| Molecular Formula | C27H35FN6O6 |
| Molecular Weight | 558.61 g/mol |
| Exact Mass | 558.26 |
| IUPAC Name | 1-[(2S,3S,4R,5R)-2-(6-aminopurin-9-yl)-3-[1-(2-fluorophenyl)-4-methoxypiperidin-4-yl]-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2,2-dimethylpropan-1-one |
| SMILES | COC1([C@@]2(O)[C@H](O)[C@@H](CO)O[C@@]2(C(=O)C(C)(C)C)n2cnc3c(N)ncnc32)CCN(c2ccccc2F)CC1 |
| InChI | InChI=1S/C27H35FN6O6/c1-24(2,3)23(37)27(34-15-32-19-21(29)30-14-31-22(19)34)26(38,20(36)18(13-35)40-27)25(39-4)9-11-33(12-10-25)17-8-6-5-7-16(17)28/h5-8,14-15,18,20,35-36,38H,9-13H2,1-4H3,(H2,29,30,31)/t18-,20-,26+,27-/m1/s1 |
| InChIKey | UIMPRTPRNFISIN-IAPZCQNZSA-N |
| XLogP | 0.98 |
| TPSA | 169.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.61 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |