C18H31N5O4Si — CID 174863822
[(2R,3R,4R,5R)-5-(6-aminopurin-9-yl)-3-[tert-butyl(dimethyl)silyl]oxy-4-methoxy-5-methyloxolan-2-yl]methanol (PubChem CID 174863822) has the molecular formula C18H31N5O4Si and a molecular weight of 409.56 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-5-(6-aminopurin-9-yl)-3-[tert-butyl(dimethyl)silyl]oxy-4-methoxy-5-methyloxolan-2-yl]methanol.
| Compound Name | [(2R,3R,4R,5R)-5-(6-aminopurin-9-yl)-3-[tert-butyl(dimethyl)silyl]oxy-4-methoxy-5-methyloxolan-2-yl]methanol |
|---|---|
| PubChem CID | 174863822 |
| Molecular Formula | C18H31N5O4Si |
| Molecular Weight | 409.56 g/mol |
| Exact Mass | 409.21 |
| IUPAC Name | [(2R,3R,4R,5R)-5-(6-aminopurin-9-yl)-3-[tert-butyl(dimethyl)silyl]oxy-4-methoxy-5-methyloxolan-2-yl]methanol |
| SMILES | CO[C@@H]1[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](CO)O[C@@]1(C)n1cnc2c(N)ncnc21 |
| InChI | InChI=1S/C18H31N5O4Si/c1-17(2,3)28(6,7)27-13-11(8-24)26-18(4,14(13)25-5)23-10-22-12-15(19)20-9-21-16(12)23/h9-11,13-14,24H,8H2,1-7H3,(H2,19,20,21)/t11-,13-,14-,18-/m1/s1 |
| InChIKey | RLBAKUKLEOINHL-XWXWGSFUSA-N |
| XLogP | 1.88 |
| TPSA | 117.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.56 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|