C17H15N5O7S — CID 87923786
[(2S,3R,4S,5S)-2-(6-aminopurin-9-yl)-3,4-dihydroxy-5-[hydroxy(sulfonyl)methyl]oxolan-2-yl]-phenylmethanone (PubChem CID 87923786) has the molecular formula C17H15N5O7S and a molecular weight of 433.40 g/mol. Its IUPAC name is [(2S,3R,4S,5S)-2-(6-aminopurin-9-yl)-3,4-dihydroxy-5-[hydroxy(sulfonyl)methyl]oxolan-2-yl]-phenylmethanone.
| Compound Name | [(2S,3R,4S,5S)-2-(6-aminopurin-9-yl)-3,4-dihydroxy-5-[hydroxy(sulfonyl)methyl]oxolan-2-yl]-phenylmethanone |
|---|---|
| PubChem CID | 87923786 |
| Molecular Formula | C17H15N5O7S |
| Molecular Weight | 433.40 g/mol |
| Exact Mass | 433.07 |
| IUPAC Name | [(2S,3R,4S,5S)-2-(6-aminopurin-9-yl)-3,4-dihydroxy-5-[hydroxy(sulfonyl)methyl]oxolan-2-yl]-phenylmethanone |
| SMILES | Nc1ncnc2c1ncn2[C@]1(C(=O)c2ccccc2)O[C@H](C(O)=S(=O)=O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C17H15N5O7S/c18-14-9-15(20-6-19-14)22(7-21-9)17(12(24)8-4-2-1-3-5-8)13(25)10(23)11(29-17)16(26)30(27)28/h1-7,10-11,13,23,25-26H,(H2,18,19,20)/t10-,11+,13-,17-/m1/s1 |
| InChIKey | VGCLKSHMIFBBPZ-WYFUGZQLSA-N |
| XLogP | -1.37 |
| TPSA | 190.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.40 |
| LogP ≤ 5 | -1.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|