C13H15N5O5 — CID 175262953
1-[(2S,3R,4S,5S)-2-(6-aminopurin-9-yl)-3,4-dihydroxy-5-(1-hydroxyethenyl)oxolan-2-yl]ethanone (PubChem CID 175262953) has the molecular formula C13H15N5O5 and a molecular weight of 321.29 g/mol. Its IUPAC name is 1-[(2S,3R,4S,5S)-2-(6-aminopurin-9-yl)-3,4-dihydroxy-5-(1-hydroxyethenyl)oxolan-2-yl]ethanone.
| Compound Name | 1-[(2S,3R,4S,5S)-2-(6-aminopurin-9-yl)-3,4-dihydroxy-5-(1-hydroxyethenyl)oxolan-2-yl]ethanone |
|---|---|
| PubChem CID | 175262953 |
| Molecular Formula | C13H15N5O5 |
| Molecular Weight | 321.29 g/mol |
| Exact Mass | 321.11 |
| IUPAC Name | 1-[(2S,3R,4S,5S)-2-(6-aminopurin-9-yl)-3,4-dihydroxy-5-(1-hydroxyethenyl)oxolan-2-yl]ethanone |
| SMILES | C=C(O)[C@H]1O[C@@](C(C)=O)(n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C13H15N5O5/c1-5(19)9-8(21)10(22)13(23-9,6(2)20)18-4-17-7-11(14)15-3-16-12(7)18/h3-4,8-10,19,21-22H,1H2,2H3,(H2,14,15,16)/t8-,9-,10-,13-/m1/s1 |
| InChIKey | YGYWCGOWOBJQDK-VWMGYNLJSA-N |
| XLogP | -1.16 |
| TPSA | 156.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.29 |
| LogP ≤ 5 | -1.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|