C10H13N5O — CID 140969390
1-(6-aminopurin-9-yl)cyclopentan-1-ol (PubChem CID 140969390) has the molecular formula C10H13N5O and a molecular weight of 219.25 g/mol. Its IUPAC name is 1-(6-aminopurin-9-yl)cyclopentan-1-ol.
| Compound Name | 1-(6-aminopurin-9-yl)cyclopentan-1-ol |
|---|---|
| PubChem CID | 140969390 |
| Molecular Formula | C10H13N5O |
| Molecular Weight | 219.25 g/mol |
| Exact Mass | 219.11 |
| IUPAC Name | 1-(6-aminopurin-9-yl)cyclopentan-1-ol |
| SMILES | Nc1ncnc2c1ncn2C1(O)CCCC1 |
| InChI | InChI=1S/C10H13N5O/c11-8-7-9(13-5-12-8)15(6-14-7)10(16)3-1-2-4-10/h5-6,16H,1-4H2,(H2,11,12,13) |
| InChIKey | QKZVMNFYFHWTDB-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 89.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.25 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |