C12H12FN5O — CID 129285347
1-(6-aminopurin-9-yl)-3-ethenyl-4-fluorocyclopent-3-en-1-ol (PubChem CID 129285347) has the molecular formula C12H12FN5O and a molecular weight of 261.26 g/mol. Its IUPAC name is 1-(6-aminopurin-9-yl)-3-ethenyl-4-fluorocyclopent-3-en-1-ol.
| Compound Name | 1-(6-aminopurin-9-yl)-3-ethenyl-4-fluorocyclopent-3-en-1-ol |
|---|---|
| PubChem CID | 129285347 |
| Molecular Formula | C12H12FN5O |
| Molecular Weight | 261.26 g/mol |
| Exact Mass | 261.10 |
| IUPAC Name | 1-(6-aminopurin-9-yl)-3-ethenyl-4-fluorocyclopent-3-en-1-ol |
| SMILES | C=CC1=C(F)CC(O)(n2cnc3c(N)ncnc32)C1 |
| InChI | InChI=1S/C12H12FN5O/c1-2-7-3-12(19,4-8(7)13)18-6-17-9-10(14)15-5-16-11(9)18/h2,5-6,19H,1,3-4H2,(H2,14,15,16) |
| InChIKey | XVANZWOCXAJWGU-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 89.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.26 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |