C11H12FN5O2 — CID 70384732
1-(6-aminopurin-9-yl)-5-(fluoromethylidene)cyclopentane-1,2-diol (PubChem CID 70384732) has the molecular formula C11H12FN5O2 and a molecular weight of 265.25 g/mol. Its IUPAC name is 1-(6-aminopurin-9-yl)-5-(fluoromethylidene)cyclopentane-1,2-diol.
| Compound Name | 1-(6-aminopurin-9-yl)-5-(fluoromethylidene)cyclopentane-1,2-diol |
|---|---|
| PubChem CID | 70384732 |
| Molecular Formula | C11H12FN5O2 |
| Molecular Weight | 265.25 g/mol |
| Exact Mass | 265.10 |
| IUPAC Name | 1-(6-aminopurin-9-yl)-5-(fluoromethylidene)cyclopentane-1,2-diol |
| SMILES | Nc1ncnc2c1ncn2C1(O)C(=CF)CCC1O |
| InChI | InChI=1S/C11H12FN5O2/c12-3-6-1-2-7(18)11(6,19)17-5-16-8-9(13)14-4-15-10(8)17/h3-5,7,18-19H,1-2H2,(H2,13,14,15) |
| InChIKey | SAKLQUNEQNJMNG-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 110.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.25 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |