C10H10FN5O3 — CID 54101612
2-(6-aminopurin-9-yl)-5-(fluoromethylidene)oxolane-3,4-diol (PubChem CID 54101612) has the molecular formula C10H10FN5O3 and a molecular weight of 267.22 g/mol. Its IUPAC name is 2-(6-aminopurin-9-yl)-5-(fluoromethylidene)oxolane-3,4-diol.
| Compound Name | 2-(6-aminopurin-9-yl)-5-(fluoromethylidene)oxolane-3,4-diol |
|---|---|
| PubChem CID | 54101612 |
| Molecular Formula | C10H10FN5O3 |
| Molecular Weight | 267.22 g/mol |
| Exact Mass | 267.08 |
| IUPAC Name | 2-(6-aminopurin-9-yl)-5-(fluoromethylidene)oxolane-3,4-diol |
| SMILES | Nc1ncnc2c1ncn2C1OC(=CF)C(O)C1O |
| InChI | InChI=1S/C10H10FN5O3/c11-1-4-6(17)7(18)10(19-4)16-3-15-5-8(12)13-2-14-9(5)16/h1-3,6-7,10,17-18H,(H2,12,13,14) |
| InChIKey | NAWIFPQLACUTSO-UHFFFAOYSA-N |
| XLogP | -0.53 |
| TPSA | 119.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.22 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |