C12H13N5O2 — CID 512658
(1S,2R,5R)-5-(6-aminopurin-9-yl)-3-ethenylcyclopent-3-ene-1,2-diol (PubChem CID 512658) has the molecular formula C12H13N5O2 and a molecular weight of 259.27 g/mol. Its IUPAC name is (1S,2R,5R)-5-(6-aminopurin-9-yl)-3-ethenylcyclopent-3-ene-1,2-diol.
| Compound Name | (1S,2R,5R)-5-(6-aminopurin-9-yl)-3-ethenylcyclopent-3-ene-1,2-diol |
|---|---|
| PubChem CID | 512658 |
| Molecular Formula | C12H13N5O2 |
| Molecular Weight | 259.27 g/mol |
| Exact Mass | 259.11 |
| IUPAC Name | (1S,2R,5R)-5-(6-aminopurin-9-yl)-3-ethenylcyclopent-3-ene-1,2-diol |
| SMILES | C=CC1=C[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C12H13N5O2/c1-2-6-3-7(10(19)9(6)18)17-5-16-8-11(13)14-4-15-12(8)17/h2-5,7,9-10,18-19H,1H2,(H2,13,14,15)/t7-,9-,10+/m1/s1 |
| InChIKey | YKUNBPPXCQOZQI-QNSHHTMESA-N |
| XLogP | -0.20 |
| TPSA | 110.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.27 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |