C16H22N6O4S — CID 10475726
2-amino-4-[[(3R,4S,5R)-3-(6-aminopurin-9-yl)-4,5-dihydroxycyclopenten-1-yl]methyl-methylsulfonio]butanoate (PubChem CID 10475726) has the molecular formula C16H22N6O4S and a molecular weight of 394.46 g/mol. Its IUPAC name is 2-amino-4-[[(3R,4S,5R)-3-(6-aminopurin-9-yl)-4,5-dihydroxycyclopenten-1-yl]methyl-methylsulfonio]butanoate.
| Compound Name | 2-amino-4-[[(3R,4S,5R)-3-(6-aminopurin-9-yl)-4,5-dihydroxycyclopenten-1-yl]methyl-methylsulfonio]butanoate |
|---|---|
| PubChem CID | 10475726 |
| Molecular Formula | C16H22N6O4S |
| Molecular Weight | 394.46 g/mol |
| Exact Mass | 394.14 |
| IUPAC Name | 2-amino-4-[[(3R,4S,5R)-3-(6-aminopurin-9-yl)-4,5-dihydroxycyclopenten-1-yl]methyl-methylsulfonio]butanoate |
| SMILES | C[S+](CCC(N)C(=O)[O-])CC1=C[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C16H22N6O4S/c1-27(3-2-9(17)16(25)26)5-8-4-10(13(24)12(8)23)22-7-21-11-14(18)19-6-20-15(11)22/h4,6-7,9-10,12-13,23-24H,2-3,5,17H2,1H3,(H2-,18,19,20,25,26)/t9?,10-,12-,13+,27?/m1/s1 |
| InChIKey | AREICCKVEUTMNR-VDJWJANNSA-N |
| XLogP | -2.67 |
| TPSA | 176.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.46 |
| LogP ≤ 5 | -2.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|