C15H21N7O3 — CID 70367470
(2S,3R,4R,5R)-2-amino-5-(5-aminopent-3-ynyl)-2-(6-aminopurin-9-yl)-3-methyloxolane-3,4-diol (PubChem CID 70367470) has the molecular formula C15H21N7O3 and a molecular weight of 347.38 g/mol. Its IUPAC name is (2S,3R,4R,5R)-2-amino-5-(5-aminopent-3-ynyl)-2-(6-aminopurin-9-yl)-3-methyloxolane-3,4-diol.
| Compound Name | (2S,3R,4R,5R)-2-amino-5-(5-aminopent-3-ynyl)-2-(6-aminopurin-9-yl)-3-methyloxolane-3,4-diol |
|---|---|
| PubChem CID | 70367470 |
| Molecular Formula | C15H21N7O3 |
| Molecular Weight | 347.38 g/mol |
| Exact Mass | 347.17 |
| IUPAC Name | (2S,3R,4R,5R)-2-amino-5-(5-aminopent-3-ynyl)-2-(6-aminopurin-9-yl)-3-methyloxolane-3,4-diol |
| SMILES | C[C@@]1(O)[C@H](O)[C@@H](CCC#CCN)O[C@@]1(N)n1cnc2c(N)ncnc21 |
| InChI | InChI=1S/C15H21N7O3/c1-14(24)11(23)9(5-3-2-4-6-16)25-15(14,18)22-8-21-10-12(17)19-7-20-13(10)22/h7-9,11,23-24H,3,5-6,16,18H2,1H3,(H2,17,19,20)/t9-,11-,14-,15+/m1/s1 |
| InChIKey | YHRYVWORNGPCSU-VGKMCQHDSA-N |
| XLogP | -1.77 |
| TPSA | 171.35 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.38 |
| LogP ≤ 5 | -1.77 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|