C14H20N6O3 — CID 139546886
9-[(3aR,4S,6aR)-6-(aminomethyl)-2,2,4-trimethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-yl]purin-6-amine (PubChem CID 139546886) has the molecular formula C14H20N6O3 and a molecular weight of 320.35 g/mol. Its IUPAC name is 9-[(3aR,4S,6aR)-6-(aminomethyl)-2,2,4-trimethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-yl]purin-6-amine.
| Compound Name | 9-[(3aR,4S,6aR)-6-(aminomethyl)-2,2,4-trimethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-yl]purin-6-amine |
|---|---|
| PubChem CID | 139546886 |
| Molecular Formula | C14H20N6O3 |
| Molecular Weight | 320.35 g/mol |
| Exact Mass | 320.16 |
| IUPAC Name | 9-[(3aR,4S,6aR)-6-(aminomethyl)-2,2,4-trimethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-yl]purin-6-amine |
| SMILES | CC1(C)O[C@@H]2C(CN)O[C@](C)(n3cnc4c(N)ncnc43)[C@@H]2O1 |
| InChI | InChI=1S/C14H20N6O3/c1-13(2)22-9-7(4-15)21-14(3,10(9)23-13)20-6-19-8-11(16)17-5-18-12(8)20/h5-7,9-10H,4,15H2,1-3H3,(H2,16,17,18)/t7?,9-,10-,14+/m1/s1 |
| InChIKey | RTQCNIJAFGCHGD-XEYKSWRNSA-N |
| XLogP | -0.04 |
| TPSA | 123.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.35 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |