C14H19N5O4 — CID 101070451
9-[[(3aS,5R,6R,6aS)-6-methoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]methyl]purin-6-amine (PubChem CID 101070451) has the molecular formula C14H19N5O4 and a molecular weight of 321.34 g/mol. Its IUPAC name is 9-[[(3aS,5R,6R,6aS)-6-methoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]methyl]purin-6-amine.
| Compound Name | 9-[[(3aS,5R,6R,6aS)-6-methoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]methyl]purin-6-amine |
|---|---|
| PubChem CID | 101070451 |
| Molecular Formula | C14H19N5O4 |
| Molecular Weight | 321.34 g/mol |
| Exact Mass | 321.14 |
| IUPAC Name | 9-[[(3aS,5R,6R,6aS)-6-methoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]methyl]purin-6-amine |
| SMILES | CO[C@H]1[C@@H]2OC(C)(C)O[C@@H]2O[C@@H]1Cn1cnc2c(N)ncnc21 |
| InChI | InChI=1S/C14H19N5O4/c1-14(2)22-10-9(20-3)7(21-13(10)23-14)4-19-6-18-8-11(15)16-5-17-12(8)19/h5-7,9-10,13H,4H2,1-3H3,(H2,15,16,17)/t7-,9-,10+,13+/m1/s1 |
| InChIKey | QJIYOVSWLRPHDV-PZWLIILKSA-N |
| XLogP | 0.30 |
| TPSA | 106.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.34 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |