C20H30N6O5 — CID 101136570
[(3aR,4R,6S,6aS)-6-[(6-aminopurin-9-yl)methyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]methyl (2S,3S)-2-amino-3-methylpentanoate (PubChem CID 101136570) has the molecular formula C20H30N6O5 and a molecular weight of 434.50 g/mol. Its IUPAC name is [(3aR,4R,6S,6aS)-6-[(6-aminopurin-9-yl)methyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]methyl (2S,3S)-2-amino-3-methylpentanoate.
| Compound Name | [(3aR,4R,6S,6aS)-6-[(6-aminopurin-9-yl)methyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]methyl (2S,3S)-2-amino-3-methylpentanoate |
|---|---|
| PubChem CID | 101136570 |
| Molecular Formula | C20H30N6O5 |
| Molecular Weight | 434.50 g/mol |
| Exact Mass | 434.23 |
| IUPAC Name | [(3aR,4R,6S,6aS)-6-[(6-aminopurin-9-yl)methyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]methyl (2S,3S)-2-amino-3-methylpentanoate |
| SMILES | CC[C@H](C)[C@H](N)C(=O)OC[C@H]1O[C@@H](Cn2cnc3c(N)ncnc32)[C@@H]2OC(C)(C)O[C@@H]21 |
| InChI | InChI=1S/C20H30N6O5/c1-5-10(2)13(21)19(27)28-7-12-16-15(30-20(3,4)31-16)11(29-12)6-26-9-25-14-17(22)23-8-24-18(14)26/h8-13,15-16H,5-7,21H2,1-4H3,(H2,22,23,24)/t10-,11-,12+,13-,15-,16+/m0/s1 |
| InChIKey | KUUAIKNEYPJJQI-RBBOIFPTSA-N |
| XLogP | 0.61 |
| TPSA | 149.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.50 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |