C16H29N7O10P2 — CID 175817360
[(2R,3R,4R,5S)-5-amino-4-(6-aminohexyl)-5-(6-aminopurin-9-yl)-4-hydroxy-2-(phosphonooxymethyl)oxolan-3-yl] dihydrogen phosphate (PubChem CID 175817360) has the molecular formula C16H29N7O10P2 and a molecular weight of 541.40 g/mol. Its IUPAC name is [(2R,3R,4R,5S)-5-amino-4-(6-aminohexyl)-5-(6-aminopurin-9-yl)-4-hydroxy-2-(phosphonooxymethyl)oxolan-3-yl] dihydrogen phosphate.
| Compound Name | [(2R,3R,4R,5S)-5-amino-4-(6-aminohexyl)-5-(6-aminopurin-9-yl)-4-hydroxy-2-(phosphonooxymethyl)oxolan-3-yl] dihydrogen phosphate |
|---|---|
| PubChem CID | 175817360 |
| Molecular Formula | C16H29N7O10P2 |
| Molecular Weight | 541.40 g/mol |
| Exact Mass | 541.15 |
| IUPAC Name | [(2R,3R,4R,5S)-5-amino-4-(6-aminohexyl)-5-(6-aminopurin-9-yl)-4-hydroxy-2-(phosphonooxymethyl)oxolan-3-yl] dihydrogen phosphate |
| SMILES | NCCCCCC[C@@]1(O)[C@H](OP(=O)(O)O)[C@@H](COP(=O)(O)O)O[C@@]1(N)n1cnc2c(N)ncnc21 |
| InChI | InChI=1S/C16H29N7O10P2/c17-6-4-2-1-3-5-15(24)12(33-35(28,29)30)10(7-31-34(25,26)27)32-16(15,19)23-9-22-11-13(18)20-8-21-14(11)23/h8-10,12,24H,1-7,17,19H2,(H2,18,20,21)(H2,25,26,27)(H2,28,29,30)/t10-,12-,15-,16+/m1/s1 |
| InChIKey | MGWNXKRCJIJREL-NODPJGRNSA-N |
| XLogP | -1.40 |
| TPSA | 284.64 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.40 |
| LogP ≤ 5 | -1.40 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|