C14H19N5O4S — CID 175849152
1-[(2S,3R,4S,5R)-2-(6-aminopurin-9-yl)-4-deuterio-5-[deuterio(hydroxy)methyl]-3,4-dihydroxyoxolan-2-yl]butane-1-thione (PubChem CID 175849152) has the molecular formula C14H19N5O4S and a molecular weight of 355.42 g/mol. Its IUPAC name is 1-[(2S,3R,4S,5R)-2-(6-aminopurin-9-yl)-4-deuterio-5-[deuterio(hydroxy)methyl]-3,4-dihydroxyoxolan-2-yl]butane-1-thione.
| Compound Name | 1-[(2S,3R,4S,5R)-2-(6-aminopurin-9-yl)-4-deuterio-5-[deuterio(hydroxy)methyl]-3,4-dihydroxyoxolan-2-yl]butane-1-thione |
|---|---|
| PubChem CID | 175849152 |
| Molecular Formula | C14H19N5O4S |
| Molecular Weight | 355.42 g/mol |
| Exact Mass | 355.13 |
| IUPAC Name | 1-[(2S,3R,4S,5R)-2-(6-aminopurin-9-yl)-4-deuterio-5-[deuterio(hydroxy)methyl]-3,4-dihydroxyoxolan-2-yl]butane-1-thione |
| SMILES | [2H]C(O)[C@H]1O[C@@](C(=S)CCC)(n2cnc3c(N)ncnc32)[C@H](O)[C@]1([2H])O |
| InChI | InChI=1S/C14H19N5O4S/c1-2-3-8(24)14(11(22)10(21)7(4-20)23-14)19-6-18-9-12(15)16-5-17-13(9)19/h5-7,10-11,20-22H,2-4H2,1H3,(H2,15,16,17)/t7-,10-,11-,14-/m1/s1/i4D,10D/t4?,7-,10-,11-,14- |
| InChIKey | FHEPHQOKLHKOJS-NVYQWAFHSA-N |
| XLogP | -0.66 |
| TPSA | 139.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.42 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|