C10H13FN5O6PS — CID 175706702
(2S,3R,4S,5R)-2-(6-aminopurin-9-yl)-4-dihydroxyphosphinothioyloxy-2-fluoro-5-(hydroxymethyl)oxolan-3-ol (PubChem CID 175706702) has the molecular formula C10H13FN5O6PS and a molecular weight of 381.28 g/mol. Its IUPAC name is (2S,3R,4S,5R)-2-(6-aminopurin-9-yl)-4-dihydroxyphosphinothioyloxy-2-fluoro-5-(hydroxymethyl)oxolan-3-ol.
| Compound Name | (2S,3R,4S,5R)-2-(6-aminopurin-9-yl)-4-dihydroxyphosphinothioyloxy-2-fluoro-5-(hydroxymethyl)oxolan-3-ol |
|---|---|
| PubChem CID | 175706702 |
| Molecular Formula | C10H13FN5O6PS |
| Molecular Weight | 381.28 g/mol |
| Exact Mass | 381.03 |
| IUPAC Name | (2S,3R,4S,5R)-2-(6-aminopurin-9-yl)-4-dihydroxyphosphinothioyloxy-2-fluoro-5-(hydroxymethyl)oxolan-3-ol |
| SMILES | Nc1ncnc2c1ncn2[C@]1(F)O[C@H](CO)[C@@H](OP(O)(O)=S)[C@H]1O |
| InChI | InChI=1S/C10H13FN5O6PS/c11-10(16-3-15-5-8(12)13-2-14-9(5)16)7(18)6(4(1-17)21-10)22-23(19,20)24/h2-4,6-7,17-18H,1H2,(H2,12,13,14)(H2,19,20,24)/t4-,6-,7-,10+/m1/s1 |
| InChIKey | PSYNGOYWUIWYQZ-CRKDRTNXSA-N |
| XLogP | -1.67 |
| TPSA | 169.00 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.28 |
| LogP ≤ 5 | -1.67 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|