C8H8N5O2P — CID 118952562
9-(1-oxo-3-oxa-1λ5-phosphabicyclo[2.1.0]pentan-4-yl)purin-6-amine (PubChem CID 118952562) has the molecular formula C8H8N5O2P and a molecular weight of 237.16 g/mol. Its IUPAC name is 9-(1-oxo-3-oxa-1λ5-phosphabicyclo[2.1.0]pentan-4-yl)purin-6-amine.
| Compound Name | 9-(1-oxo-3-oxa-1λ5-phosphabicyclo[2.1.0]pentan-4-yl)purin-6-amine |
|---|---|
| PubChem CID | 118952562 |
| Molecular Formula | C8H8N5O2P |
| Molecular Weight | 237.16 g/mol |
| Exact Mass | 237.04 |
| IUPAC Name | 9-(1-oxo-3-oxa-1λ5-phosphabicyclo[2.1.0]pentan-4-yl)purin-6-amine |
| SMILES | Nc1ncnc2c1ncn2C12CP1(=O)CO2 |
| InChI | InChI=1S/C8H8N5O2P/c9-6-5-7(11-2-10-6)13(3-12-5)8-1-16(8,14)4-15-8/h2-3H,1,4H2,(H2,9,10,11) |
| InChIKey | KNKFSMVNFRYEFW-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 95.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.16 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|