C8H7ClN5O2P — CID 87100321
6-chloro-9-(1-oxo-3-oxa-1λ5-phosphabicyclo[2.1.0]pentan-4-yl)purin-2-amine (PubChem CID 87100321) has the molecular formula C8H7ClN5O2P and a molecular weight of 271.60 g/mol. Its IUPAC name is 6-chloro-9-(1-oxo-3-oxa-1λ5-phosphabicyclo[2.1.0]pentan-4-yl)purin-2-amine.
| Compound Name | 6-chloro-9-(1-oxo-3-oxa-1λ5-phosphabicyclo[2.1.0]pentan-4-yl)purin-2-amine |
|---|---|
| PubChem CID | 87100321 |
| Molecular Formula | C8H7ClN5O2P |
| Molecular Weight | 271.60 g/mol |
| Exact Mass | 271.00 |
| IUPAC Name | 6-chloro-9-(1-oxo-3-oxa-1λ5-phosphabicyclo[2.1.0]pentan-4-yl)purin-2-amine |
| SMILES | Nc1nc(Cl)c2ncn(C34CP3(=O)CO4)c2n1 |
| InChI | InChI=1S/C8H7ClN5O2P/c9-5-4-6(13-7(10)12-5)14(2-11-4)8-1-17(8,15)3-16-8/h2H,1,3H2,(H2,10,12,13) |
| InChIKey | LPNBHEDVVSSOEH-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 95.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.60 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|