C24H28N10O6S — CID 145288554
2-amino-N-[[(2R,3R,4R)-4-[6-amino-2-[3-(aminomethyl)anilino]purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methylsulfamoyl]benzamide (PubChem CID 145288554) has the molecular formula C24H28N10O6S and a molecular weight of 584.62 g/mol. Its IUPAC name is 2-amino-N-[[(2R,3R,4R)-4-[6-amino-2-[3-(aminomethyl)anilino]purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methylsulfamoyl]benzamide.
| Compound Name | 2-amino-N-[[(2R,3R,4R)-4-[6-amino-2-[3-(aminomethyl)anilino]purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methylsulfamoyl]benzamide |
|---|---|
| PubChem CID | 145288554 |
| Molecular Formula | C24H28N10O6S |
| Molecular Weight | 584.62 g/mol |
| Exact Mass | 584.19 |
| IUPAC Name | 2-amino-N-[[(2R,3R,4R)-4-[6-amino-2-[3-(aminomethyl)anilino]purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methylsulfamoyl]benzamide |
| SMILES | NCc1cccc(Nc2nc(N)c3ncn([C@@]4(O)CO[C@H](CNS(=O)(=O)NC(=O)c5ccccc5N)[C@H]4O)c3n2)c1 |
| InChI | InChI=1S/C24H28N10O6S/c25-9-13-4-3-5-14(8-13)30-23-31-20(27)18-21(32-23)34(12-28-18)24(37)11-40-17(19(24)35)10-29-41(38,39)33-22(36)15-6-1-2-7-16(15)26/h1-8,12,17,19,29,35,37H,9-11,25-26H2,(H,33,36)(H3,27,30,31,32)/t17-,19-,24-/m1/s1 |
| InChIKey | GGZYCQOQRQCXDE-ROMRWMGNSA-N |
| XLogP | -1.14 |
| TPSA | 258.65 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.62 |
| LogP ≤ 5 | -1.14 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|