C13H19N3O6S — CID 145288540
2-amino-N-[[(2R,3S,4R,5S)-3,4-dihydroxy-5-methyloxolan-2-yl]methylsulfamoyl]benzamide (PubChem CID 145288540) has the molecular formula C13H19N3O6S and a molecular weight of 345.38 g/mol. Its IUPAC name is 2-amino-N-[[(2R,3S,4R,5S)-3,4-dihydroxy-5-methyloxolan-2-yl]methylsulfamoyl]benzamide.
| Compound Name | 2-amino-N-[[(2R,3S,4R,5S)-3,4-dihydroxy-5-methyloxolan-2-yl]methylsulfamoyl]benzamide |
|---|---|
| PubChem CID | 145288540 |
| Molecular Formula | C13H19N3O6S |
| Molecular Weight | 345.38 g/mol |
| Exact Mass | 345.10 |
| IUPAC Name | 2-amino-N-[[(2R,3S,4R,5S)-3,4-dihydroxy-5-methyloxolan-2-yl]methylsulfamoyl]benzamide |
| SMILES | C[C@@H]1O[C@H](CNS(=O)(=O)NC(=O)c2ccccc2N)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C13H19N3O6S/c1-7-11(17)12(18)10(22-7)6-15-23(20,21)16-13(19)8-4-2-3-5-9(8)14/h2-5,7,10-12,15,17-18H,6,14H2,1H3,(H,16,19)/t7-,10+,11-,12+/m0/s1 |
| InChIKey | BMPPCMMRSALDFT-FPQWWODTSA-N |
| XLogP | -1.66 |
| TPSA | 150.98 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.38 |
| LogP ≤ 5 | -1.66 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|