C17H19FN7O6S+ — CID 122231985
N-[[(2R,3R,4R,5R)-5-(6-amino-7H-purin-9-ium-9-yl)-4-fluoro-3-hydroxyoxolan-2-yl]methylsulfamoyl]-2-hydroxybenzamide (PubChem CID 122231985) has the molecular formula C17H19FN7O6S+ and a molecular weight of 468.45 g/mol. Its IUPAC name is N-[[(2R,3R,4R,5R)-5-(6-amino-7H-purin-9-ium-9-yl)-4-fluoro-3-hydroxyoxolan-2-yl]methylsulfamoyl]-2-hydroxybenzamide.
| Compound Name | N-[[(2R,3R,4R,5R)-5-(6-amino-7H-purin-9-ium-9-yl)-4-fluoro-3-hydroxyoxolan-2-yl]methylsulfamoyl]-2-hydroxybenzamide |
|---|---|
| PubChem CID | 122231985 |
| Molecular Formula | C17H19FN7O6S+ |
| Molecular Weight | 468.45 g/mol |
| Exact Mass | 468.11 |
| IUPAC Name | N-[[(2R,3R,4R,5R)-5-(6-amino-7H-purin-9-ium-9-yl)-4-fluoro-3-hydroxyoxolan-2-yl]methylsulfamoyl]-2-hydroxybenzamide |
| SMILES | Nc1ncnc2c1[nH]c[n+]2[C@@H]1O[C@H](CNS(=O)(=O)NC(=O)c2ccccc2O)[C@@H](O)[C@H]1F |
| InChI | InChI=1S/C17H18FN7O6S/c18-11-13(27)10(31-17(11)25-7-22-12-14(19)20-6-21-15(12)25)5-23-32(29,30)24-16(28)8-3-1-2-4-9(8)26/h1-4,6-7,10-11,13,17,23,27H,5H2,(H4,19,20,21,24,26,28)/p+1/t10-,11-,13-,17-/m1/s1 |
| InChIKey | OBUQAIPLVHPANF-YAMOITTJSA-O |
| XLogP | -1.61 |
| TPSA | 196.43 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.45 |
| LogP ≤ 5 | -1.61 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|