C17H19N6O8S+ — CID 101417742
[(2R,3S,4R,5R)-5-(6-amino-7H-purin-9-ium-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl N-(4-hydroxybenzoyl)sulfamate (PubChem CID 101417742) has the molecular formula C17H19N6O8S+ and a molecular weight of 467.44 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-(6-amino-7H-purin-9-ium-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl N-(4-hydroxybenzoyl)sulfamate.
| Compound Name | [(2R,3S,4R,5R)-5-(6-amino-7H-purin-9-ium-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl N-(4-hydroxybenzoyl)sulfamate |
|---|---|
| PubChem CID | 101417742 |
| Molecular Formula | C17H19N6O8S+ |
| Molecular Weight | 467.44 g/mol |
| Exact Mass | 467.10 |
| IUPAC Name | [(2R,3S,4R,5R)-5-(6-amino-7H-purin-9-ium-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl N-(4-hydroxybenzoyl)sulfamate |
| SMILES | Nc1ncnc2c1[nH]c[n+]2[C@@H]1O[C@H](COS(=O)(=O)NC(=O)c2ccc(O)cc2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C17H18N6O8S/c18-14-11-15(20-6-19-14)23(7-21-11)17-13(26)12(25)10(31-17)5-30-32(28,29)22-16(27)8-1-3-9(24)4-2-8/h1-4,6-7,10,12-13,17,25-26H,5H2,(H4,18,19,20,22,24,27)/p+1/t10-,12-,13-,17-/m1/s1 |
| InChIKey | SGWZAKSMMFKDCY-CNEMSGBDSA-O |
| XLogP | -2.16 |
| TPSA | 213.86 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.44 |
| LogP ≤ 5 | -2.16 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|