C11H16N5O7P — CID 5232176
[5-(6-amino-7H-purin-9-ium-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl methyl phosphate (PubChem CID 5232176) has the molecular formula C11H16N5O7P and a molecular weight of 361.25 g/mol. Its IUPAC name is [5-(6-amino-7H-purin-9-ium-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl methyl phosphate.
| Compound Name | [5-(6-amino-7H-purin-9-ium-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl methyl phosphate |
|---|---|
| PubChem CID | 5232176 |
| Molecular Formula | C11H16N5O7P |
| Molecular Weight | 361.25 g/mol |
| Exact Mass | 361.08 |
| IUPAC Name | [5-(6-amino-7H-purin-9-ium-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl methyl phosphate |
| SMILES | COP(=O)([O-])OCC1OC([n+]2c[nH]c3c(N)ncnc32)C(O)C1O |
| InChI | InChI=1S/C11H16N5O7P/c1-21-24(19,20)22-2-5-7(17)8(18)11(23-5)16-4-15-6-9(12)13-3-14-10(6)16/h3-5,7-8,11,17-18H,2H2,1H3,(H3,12,13,14,19,20) |
| InChIKey | PUKKUJMPDHKUJL-UHFFFAOYSA-N |
| XLogP | -2.42 |
| TPSA | 179.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.25 |
| LogP ≤ 5 | -2.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|