C18H30N7O6+ — CID 163587221
N-[(2R,4R,5R)-2-(6-amino-7H-purin-9-ium-9-yl)-4-hydroxy-5-(hydroxymethyl)oxolan-3-yl]-2-(methoxymethoxymethylamino)pentanamide (PubChem CID 163587221) has the molecular formula C18H30N7O6+ and a molecular weight of 440.48 g/mol. Its IUPAC name is N-[(2R,4R,5R)-2-(6-amino-7H-purin-9-ium-9-yl)-4-hydroxy-5-(hydroxymethyl)oxolan-3-yl]-2-(methoxymethoxymethylamino)pentanamide.
| Compound Name | N-[(2R,4R,5R)-2-(6-amino-7H-purin-9-ium-9-yl)-4-hydroxy-5-(hydroxymethyl)oxolan-3-yl]-2-(methoxymethoxymethylamino)pentanamide |
|---|---|
| PubChem CID | 163587221 |
| Molecular Formula | C18H30N7O6+ |
| Molecular Weight | 440.48 g/mol |
| Exact Mass | 440.23 |
| IUPAC Name | N-[(2R,4R,5R)-2-(6-amino-7H-purin-9-ium-9-yl)-4-hydroxy-5-(hydroxymethyl)oxolan-3-yl]-2-(methoxymethoxymethylamino)pentanamide |
| SMILES | CCCC(NCOCOC)C(=O)NC1[C@@H](O)[C@@H](CO)O[C@H]1[n+]1c[nH]c2c(N)ncnc21 |
| InChI | InChI=1S/C18H29N7O6/c1-3-4-10(23-8-30-9-29-2)17(28)24-12-14(27)11(5-26)31-18(12)25-7-22-13-15(19)20-6-21-16(13)25/h6-7,10-12,14,18,23,26-27H,3-5,8-9H2,1-2H3,(H3,19,20,21,24,28)/p+1/t10?,11-,12?,14+,18-/m1/s1 |
| InChIKey | VLBXMVXENQYYLD-YUXJRNHGSA-O |
| XLogP | -2.10 |
| TPSA | 180.75 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.48 |
| LogP ≤ 5 | -2.10 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|