C24H25N7O3 — CID 139447927
4-(6-aminopurin-9-yl)-2-[(2-carbazol-9-ylethylamino)methyl]oxolane-3,4-diol (PubChem CID 139447927) has the molecular formula C24H25N7O3 and a molecular weight of 459.51 g/mol. Its IUPAC name is 4-(6-aminopurin-9-yl)-2-[(2-carbazol-9-ylethylamino)methyl]oxolane-3,4-diol.
| Compound Name | 4-(6-aminopurin-9-yl)-2-[(2-carbazol-9-ylethylamino)methyl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 139447927 |
| Molecular Formula | C24H25N7O3 |
| Molecular Weight | 459.51 g/mol |
| Exact Mass | 459.20 |
| IUPAC Name | 4-(6-aminopurin-9-yl)-2-[(2-carbazol-9-ylethylamino)methyl]oxolane-3,4-diol |
| SMILES | Nc1ncnc2c1ncn2C1(O)COC(CNCCn2c3ccccc3c3ccccc32)C1O |
| InChI | InChI=1S/C24H25N7O3/c25-22-20-23(28-13-27-22)31(14-29-20)24(33)12-34-19(21(24)32)11-26-9-10-30-17-7-3-1-5-15(17)16-6-2-4-8-18(16)30/h1-8,13-14,19,21,26,32-33H,9-12H2,(H2,25,27,28) |
| InChIKey | MVMKQGCQUNDZMS-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 136.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.51 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|